C12H14N2O4 — CID 123840193
(3R)-3-[4-(nitrosomethyl)phenyl]morpholine-4-carboxylic acid (PubChem CID 123840193) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is (3R)-3-[4-(nitrosomethyl)phenyl]morpholine-4-carboxylic acid.
| Compound Name | (3R)-3-[4-(nitrosomethyl)phenyl]morpholine-4-carboxylic acid |
|---|---|
| PubChem CID | 123840193 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (3R)-3-[4-(nitrosomethyl)phenyl]morpholine-4-carboxylic acid |
| SMILES | O=NCc1ccc([C@@H]2COCCN2C(=O)O)cc1 |
| InChI | InChI=1S/C12H14N2O4/c15-12(16)14-5-6-18-8-11(14)10-3-1-9(2-4-10)7-13-17/h1-4,11H,5-8H2,(H,15,16)/t11-/m0/s1 |
| InChIKey | YMEJGYWBBKTJSV-NSHDSACASA-N |
| XLogP | 2.00 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |