C18H26F3N — CID 123840601
4-(2,4-difluoro-5-methylcyclohept-3-en-1-yl)-6-fluoro-2,3,4,4a,7,8,9,9a-octahydro-1H-cyclohepta[c]pyridine (PubChem CID 123840601) has the molecular formula C18H26F3N and a molecular weight of 313.41 g/mol. Its IUPAC name is 4-(2,4-difluoro-5-methylcyclohept-3-en-1-yl)-6-fluoro-2,3,4,4a,7,8,9,9a-octahydro-1H-cyclohepta[c]pyridine.
| Compound Name | 4-(2,4-difluoro-5-methylcyclohept-3-en-1-yl)-6-fluoro-2,3,4,4a,7,8,9,9a-octahydro-1H-cyclohepta[c]pyridine |
|---|---|
| PubChem CID | 123840601 |
| Molecular Formula | C18H26F3N |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 4-(2,4-difluoro-5-methylcyclohept-3-en-1-yl)-6-fluoro-2,3,4,4a,7,8,9,9a-octahydro-1H-cyclohepta[c]pyridine |
| SMILES | CC1CCC(C2CNCC3CCCC(F)=CC32)C(F)C=C1F |
| InChI | InChI=1S/C18H26F3N/c1-11-5-6-14(18(21)8-17(11)20)16-10-22-9-12-3-2-4-13(19)7-15(12)16/h7-8,11-12,14-16,18,22H,2-6,9-10H2,1H3 |
| InChIKey | LWMODZJFFNIHKJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |