C23H32OS3 — CID 123840640
7-hexyl-7-pentyl-10-prop-1-en-2-yl-3,7λ4,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4-carbaldehyde (PubChem CID 123840640) has the molecular formula C23H32OS3 and a molecular weight of 420.71 g/mol. Its IUPAC name is 7-hexyl-7-pentyl-10-prop-1-en-2-yl-3,7λ4,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4-carbaldehyde.
| Compound Name | 7-hexyl-7-pentyl-10-prop-1-en-2-yl-3,7λ4,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4-carbaldehyde |
|---|---|
| PubChem CID | 123840640 |
| Molecular Formula | C23H32OS3 |
| Molecular Weight | 420.71 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 7-hexyl-7-pentyl-10-prop-1-en-2-yl-3,7λ4,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4-carbaldehyde |
| SMILES | C=C(C)c1cc2c(s1)-c1sc(C=O)cc1S2(CCCCC)CCCCCC |
| InChI | InChI=1S/C23H32OS3/c1-5-7-9-11-13-27(12-10-8-6-2)20-14-18(16-24)25-22(20)23-21(27)15-19(26-23)17(3)4/h14-16H,3,5-13H2,1-2,4H3 |
| InChIKey | IKBZDTDSGGXRKT-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.71 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|