C13H16N2O5 — CID 123840785
(3S,4S)-4-(1-methyl-2-oxo-4-pyridinyl)piperidine-1,3-dicarboxylic acid (PubChem CID 123840785) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is (3S,4S)-4-(1-methyl-2-oxo-4-pyridinyl)piperidine-1,3-dicarboxylic acid.
| Compound Name | (3S,4S)-4-(1-methyl-2-oxo-4-pyridinyl)piperidine-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 123840785 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (3S,4S)-4-(1-methyl-2-oxo-4-pyridinyl)piperidine-1,3-dicarboxylic acid |
| SMILES | Cn1ccc([C@H]2CCN(C(=O)O)C[C@H]2C(=O)O)cc1=O |
| InChI | InChI=1S/C13H16N2O5/c1-14-4-2-8(6-11(14)16)9-3-5-15(13(19)20)7-10(9)12(17)18/h2,4,6,9-10H,3,5,7H2,1H3,(H,17,18)(H,19,20)/t9-,10-/m1/s1 |
| InChIKey | DORCHDUCZJLDLM-NXEZZACHSA-N |
| XLogP | 0.55 |
| TPSA | 99.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |