About 3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienal
3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienal (PubChem CID 123840886) has the molecular formula C26H50O2Si
and a molecular weight of 422.77 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienal.
Molecular Properties
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienal |
| PubChem CID | 123840886 |
| Molecular Formula | C26H50O2Si |
| Molecular Weight | 422.77 g/mol |
| Exact Mass | 422.36 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienal |
| SMILES | CCCCCC=CCC=CCCCCCCCC(CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H50O2Si/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25(23-24-27)28-29(5,6)26(2,3)4/h11-12,14-15,24-25H,7-10,13,16-23H2,1-6H3 |
| InChIKey | WWBVCNPNOBIKOS-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.77 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienal?
The IUPAC name of 3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienal (CID 123840886) is 3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienal.
What is the SMILES notation for 3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienal?
The canonical SMILES for 3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienal is CCCCCC=CCC=CCCCCCCCC(CC=O)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of 3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienal?
The InChIKey is WWBVCNPNOBIKOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H50O2Si/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25(23-24-27)28-29(5,6)26(2,3)4/h11-12,14-15,24-25H,7-10,13,16-23H2,1-6H3.
What are the key properties of 3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienal?
3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienal has a molecular weight of 422.77 g/mol, XLogP of 8.78, 18 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienal is sourced from PubChem (CID 123840886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).