C35H40O3 — CID 123841110
1,3-diphenyl-2-[1-[4-(2,2,4-trimethylhexan-3-yl)phenoxy]ethylperoxy]benzene (PubChem CID 123841110) has the molecular formula C35H40O3 and a molecular weight of 508.70 g/mol. Its IUPAC name is 1,3-diphenyl-2-[1-[4-(2,2,4-trimethylhexan-3-yl)phenoxy]ethylperoxy]benzene.
| Compound Name | 1,3-diphenyl-2-[1-[4-(2,2,4-trimethylhexan-3-yl)phenoxy]ethylperoxy]benzene |
|---|---|
| PubChem CID | 123841110 |
| Molecular Formula | C35H40O3 |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | 1,3-diphenyl-2-[1-[4-(2,2,4-trimethylhexan-3-yl)phenoxy]ethylperoxy]benzene |
| SMILES | CCC(C)C(c1ccc(OC(C)OOc2c(-c3ccccc3)cccc2-c2ccccc2)cc1)C(C)(C)C |
| InChI | InChI=1S/C35H40O3/c1-7-25(2)33(35(4,5)6)29-21-23-30(24-22-29)36-26(3)37-38-34-31(27-15-10-8-11-16-27)19-14-20-32(34)28-17-12-9-13-18-28/h8-26,33H,7H2,1-6H3 |
| InChIKey | PPCQLFHMZZMYHS-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|