C7H7NO2S2 — CID 123841201
1,1-dioxo-2,3-dihydro-1,2-benzothiazole-6-thiol (PubChem CID 123841201) has the molecular formula C7H7NO2S2 and a molecular weight of 201.27 g/mol. Its IUPAC name is 1,1-dioxo-2,3-dihydro-1,2-benzothiazole-6-thiol.
| Compound Name | 1,1-dioxo-2,3-dihydro-1,2-benzothiazole-6-thiol |
|---|---|
| PubChem CID | 123841201 |
| Molecular Formula | C7H7NO2S2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 200.99 |
| IUPAC Name | 1,1-dioxo-2,3-dihydro-1,2-benzothiazole-6-thiol |
| SMILES | O=S1(=O)NCc2ccc(S)cc21 |
| InChI | InChI=1S/C7H7NO2S2/c9-12(10)7-3-6(11)2-1-5(7)4-8-12/h1-3,8,11H,4H2 |
| InChIKey | FOWCSHGMRPWVPO-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|