About (3R)-3-(azidomethyl)-1,3,4-trihydroxybutan-2-one
(3R)-3-(azidomethyl)-1,3,4-trihydroxybutan-2-one (PubChem CID 123841420) has the molecular formula C5H9N3O4
and a molecular weight of 175.14 g/mol. Its IUPAC name is (3R)-3-(azidomethyl)-1,3,4-trihydroxybutan-2-one.
Molecular Properties
| Compound Name | (3R)-3-(azidomethyl)-1,3,4-trihydroxybutan-2-one |
| PubChem CID | 123841420 |
| Molecular Formula | C5H9N3O4 |
| Molecular Weight | 175.14 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | (3R)-3-(azidomethyl)-1,3,4-trihydroxybutan-2-one |
| SMILES | [N-]=[N+]=NC[C@@](O)(CO)C(=O)CO |
| InChI | InChI=1S/C5H9N3O4/c6-8-7-2-5(12,3-10)4(11)1-9/h9-10,12H,1-3H2/t5-/m1/s1 |
| InChIKey | JIWYWPPSGFKDGO-RXMQYKEDSA-N |
| XLogP | -1.42 |
| TPSA | 126.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.14 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-(azidomethyl)-1,3,4-trihydroxybutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(azidomethyl)-1,3,4-trihydroxybutan-2-one?
The IUPAC name of (3R)-3-(azidomethyl)-1,3,4-trihydroxybutan-2-one (CID 123841420) is (3R)-3-(azidomethyl)-1,3,4-trihydroxybutan-2-one.
What is the SMILES notation for (3R)-3-(azidomethyl)-1,3,4-trihydroxybutan-2-one?
The canonical SMILES for (3R)-3-(azidomethyl)-1,3,4-trihydroxybutan-2-one is [N-]=[N+]=NC[C@@](O)(CO)C(=O)CO.
What is the InChIKey of (3R)-3-(azidomethyl)-1,3,4-trihydroxybutan-2-one?
The InChIKey is JIWYWPPSGFKDGO-RXMQYKEDSA-N. The full InChI is InChI=1S/C5H9N3O4/c6-8-7-2-5(12,3-10)4(11)1-9/h9-10,12H,1-3H2/t5-/m1/s1.
What are the key properties of (3R)-3-(azidomethyl)-1,3,4-trihydroxybutan-2-one?
(3R)-3-(azidomethyl)-1,3,4-trihydroxybutan-2-one has a molecular weight of 175.14 g/mol, XLogP of -1.42, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(azidomethyl)-1,3,4-trihydroxybutan-2-one is sourced from PubChem (CID 123841420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).