About methyl 5-propoxypent-2-enyl carbonate
methyl 5-propoxypent-2-enyl carbonate (PubChem CID 123841485) has the molecular formula C10H18O4
and a molecular weight of 202.25 g/mol. Its IUPAC name is methyl 5-propoxypent-2-enyl carbonate.
Molecular Properties
| Compound Name | methyl 5-propoxypent-2-enyl carbonate |
| PubChem CID | 123841485 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | methyl 5-propoxypent-2-enyl carbonate |
| SMILES | CCCOCCC=CCOC(=O)OC |
| InChI | InChI=1S/C10H18O4/c1-3-7-13-8-5-4-6-9-14-10(11)12-2/h4,6H,3,5,7-9H2,1-2H3 |
| InChIKey | DLBRAVSJSIQTKF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-propoxypent-2-enyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-propoxypent-2-enyl carbonate?
The IUPAC name of methyl 5-propoxypent-2-enyl carbonate (CID 123841485) is methyl 5-propoxypent-2-enyl carbonate.
What is the SMILES notation for methyl 5-propoxypent-2-enyl carbonate?
The canonical SMILES for methyl 5-propoxypent-2-enyl carbonate is CCCOCCC=CCOC(=O)OC.
What is the InChIKey of methyl 5-propoxypent-2-enyl carbonate?
The InChIKey is DLBRAVSJSIQTKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4/c1-3-7-13-8-5-4-6-9-14-10(11)12-2/h4,6H,3,5,7-9H2,1-2H3.
What are the key properties of methyl 5-propoxypent-2-enyl carbonate?
methyl 5-propoxypent-2-enyl carbonate has a molecular weight of 202.25 g/mol, XLogP of 2.14, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-propoxypent-2-enyl carbonate is sourced from PubChem (CID 123841485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).