C18H18F2N4OS — CID 123841760
(3-amino-6-methyl-7,8-dihydro-5H-thieno[2,3-b][1,6]naphthyridin-2-yl)-(3,4-difluoroanilino)methanol (PubChem CID 123841760) has the molecular formula C18H18F2N4OS and a molecular weight of 376.43 g/mol. Its IUPAC name is (3-amino-6-methyl-7,8-dihydro-5H-thieno[2,3-b][1,6]naphthyridin-2-yl)-(3,4-difluoroanilino)methanol.
| Compound Name | (3-amino-6-methyl-7,8-dihydro-5H-thieno[2,3-b][1,6]naphthyridin-2-yl)-(3,4-difluoroanilino)methanol |
|---|---|
| PubChem CID | 123841760 |
| Molecular Formula | C18H18F2N4OS |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | (3-amino-6-methyl-7,8-dihydro-5H-thieno[2,3-b][1,6]naphthyridin-2-yl)-(3,4-difluoroanilino)methanol |
| SMILES | CN1CCc2nc3sc(C(O)Nc4ccc(F)c(F)c4)c(N)c3cc2C1 |
| InChI | InChI=1S/C18H18F2N4OS/c1-24-5-4-14-9(8-24)6-11-15(21)16(26-18(11)23-14)17(25)22-10-2-3-12(19)13(20)7-10/h2-3,6-7,17,22,25H,4-5,8,21H2,1H3 |
| InChIKey | XIPXBAFGPIOSQM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|