About 2-propan-2-yl-4,5-bis(prop-1-enyl)pyrimidine
2-propan-2-yl-4,5-bis(prop-1-enyl)pyrimidine (PubChem CID 123841896) has the molecular formula C13H18N2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-propan-2-yl-4,5-bis(prop-1-enyl)pyrimidine.
Molecular Properties
| Compound Name | 2-propan-2-yl-4,5-bis(prop-1-enyl)pyrimidine |
| PubChem CID | 123841896 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 2-propan-2-yl-4,5-bis(prop-1-enyl)pyrimidine |
| SMILES | CC=Cc1cnc(C(C)C)nc1C=CC |
| InChI | InChI=1S/C13H18N2/c1-5-7-11-9-14-13(10(3)4)15-12(11)8-6-2/h5-10H,1-4H3 |
| InChIKey | BLUMNMNUYJPNMK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propan-2-yl-4,5-bis(prop-1-enyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-4,5-bis(prop-1-enyl)pyrimidine?
The IUPAC name of 2-propan-2-yl-4,5-bis(prop-1-enyl)pyrimidine (CID 123841896) is 2-propan-2-yl-4,5-bis(prop-1-enyl)pyrimidine.
What is the SMILES notation for 2-propan-2-yl-4,5-bis(prop-1-enyl)pyrimidine?
The canonical SMILES for 2-propan-2-yl-4,5-bis(prop-1-enyl)pyrimidine is CC=Cc1cnc(C(C)C)nc1C=CC.
What is the InChIKey of 2-propan-2-yl-4,5-bis(prop-1-enyl)pyrimidine?
The InChIKey is BLUMNMNUYJPNMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2/c1-5-7-11-9-14-13(10(3)4)15-12(11)8-6-2/h5-10H,1-4H3.
What are the key properties of 2-propan-2-yl-4,5-bis(prop-1-enyl)pyrimidine?
2-propan-2-yl-4,5-bis(prop-1-enyl)pyrimidine has a molecular weight of 202.30 g/mol, XLogP of 3.67, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-4,5-bis(prop-1-enyl)pyrimidine is sourced from PubChem (CID 123841896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).