About carboxymethyl-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-oxoethyl]-methanidylazanium
carboxymethyl-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-oxoethyl]-methanidylazanium (PubChem CID 123842414) has the molecular formula C9H16N2O5S
and a molecular weight of 264.30 g/mol. Its IUPAC name is carboxymethyl-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-oxoethyl]-methanidylazanium.
Molecular Properties
| Compound Name | carboxymethyl-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-oxoethyl]-methanidylazanium |
| PubChem CID | 123842414 |
| Molecular Formula | C9H16N2O5S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | carboxymethyl-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-oxoethyl]-methanidylazanium |
| SMILES | [CH2-][NH+](CC(=O)O)CC(=O)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H16N2O5S/c1-10(7-9(13)14)6-8(12)11-2-4-17(15,16)5-3-11/h10H,1-7H2,(H,13,14) |
| InChIKey | NCZZKMMISJUVDL-UHFFFAOYSA-N |
| XLogP | -3.00 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carboxymethyl-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-oxoethyl]-methanidylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carboxymethyl-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-oxoethyl]-methanidylazanium?
The IUPAC name of carboxymethyl-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-oxoethyl]-methanidylazanium (CID 123842414) is carboxymethyl-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-oxoethyl]-methanidylazanium.
What is the SMILES notation for carboxymethyl-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-oxoethyl]-methanidylazanium?
The canonical SMILES for carboxymethyl-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-oxoethyl]-methanidylazanium is [CH2-][NH+](CC(=O)O)CC(=O)N1CCS(=O)(=O)CC1.
What is the InChIKey of carboxymethyl-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-oxoethyl]-methanidylazanium?
The InChIKey is NCZZKMMISJUVDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O5S/c1-10(7-9(13)14)6-8(12)11-2-4-17(15,16)5-3-11/h10H,1-7H2,(H,13,14).
What are the key properties of carboxymethyl-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-oxoethyl]-methanidylazanium?
carboxymethyl-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-oxoethyl]-methanidylazanium has a molecular weight of 264.30 g/mol, XLogP of -3.00, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carboxymethyl-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-oxoethyl]-methanidylazanium is sourced from PubChem (CID 123842414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).