About 3-(4-fluorophenyl)-3,4-dihydro-2H-1,4-benzothiazine-2-carbonitrile
3-(4-fluorophenyl)-3,4-dihydro-2H-1,4-benzothiazine-2-carbonitrile (PubChem CID 123842421) has the molecular formula C15H11FN2S
and a molecular weight of 270.33 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-3,4-dihydro-2H-1,4-benzothiazine-2-carbonitrile.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)-3,4-dihydro-2H-1,4-benzothiazine-2-carbonitrile |
| PubChem CID | 123842421 |
| Molecular Formula | C15H11FN2S |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 3-(4-fluorophenyl)-3,4-dihydro-2H-1,4-benzothiazine-2-carbonitrile |
| SMILES | N#CC1Sc2ccccc2NC1c1ccc(F)cc1 |
| InChI | InChI=1S/C15H11FN2S/c16-11-7-5-10(6-8-11)15-14(9-17)19-13-4-2-1-3-12(13)18-15/h1-8,14-15,18H |
| InChIKey | WNSWHQVQJPGAJT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-fluorophenyl)-3,4-dihydro-2H-1,4-benzothiazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)-3,4-dihydro-2H-1,4-benzothiazine-2-carbonitrile?
The IUPAC name of 3-(4-fluorophenyl)-3,4-dihydro-2H-1,4-benzothiazine-2-carbonitrile (CID 123842421) is 3-(4-fluorophenyl)-3,4-dihydro-2H-1,4-benzothiazine-2-carbonitrile.
What is the SMILES notation for 3-(4-fluorophenyl)-3,4-dihydro-2H-1,4-benzothiazine-2-carbonitrile?
The canonical SMILES for 3-(4-fluorophenyl)-3,4-dihydro-2H-1,4-benzothiazine-2-carbonitrile is N#CC1Sc2ccccc2NC1c1ccc(F)cc1.
What is the InChIKey of 3-(4-fluorophenyl)-3,4-dihydro-2H-1,4-benzothiazine-2-carbonitrile?
The InChIKey is WNSWHQVQJPGAJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11FN2S/c16-11-7-5-10(6-8-11)15-14(9-17)19-13-4-2-1-3-12(13)18-15/h1-8,14-15,18H.
What are the key properties of 3-(4-fluorophenyl)-3,4-dihydro-2H-1,4-benzothiazine-2-carbonitrile?
3-(4-fluorophenyl)-3,4-dihydro-2H-1,4-benzothiazine-2-carbonitrile has a molecular weight of 270.33 g/mol, XLogP of 3.98, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-3,4-dihydro-2H-1,4-benzothiazine-2-carbonitrile is sourced from PubChem (CID 123842421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).