C20H27NO — CID 123842631
2-butan-2-yl-N-cyclobutyl-5-(2-cyclopropylethynyl)hepta-2,4,6-trienamide (PubChem CID 123842631) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is 2-butan-2-yl-N-cyclobutyl-5-(2-cyclopropylethynyl)hepta-2,4,6-trienamide.
| Compound Name | 2-butan-2-yl-N-cyclobutyl-5-(2-cyclopropylethynyl)hepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 123842631 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 2-butan-2-yl-N-cyclobutyl-5-(2-cyclopropylethynyl)hepta-2,4,6-trienamide |
| SMILES | C=CC(C#CC1CC1)=CC=C(C(=O)NC1CCC1)C(C)CC |
| InChI | InChI=1S/C20H27NO/c1-4-15(3)19(20(22)21-18-7-6-8-18)14-13-16(5-2)9-10-17-11-12-17/h5,13-15,17-18H,2,4,6-8,11-12H2,1,3H3,(H,21,22) |
| InChIKey | UXCCXEKIZJCLJN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|