About N-methyl-6-(2-methylbutan-2-yl)-2-(methylideneamino)-3-penta-1,3-dien-3-ylaniline
N-methyl-6-(2-methylbutan-2-yl)-2-(methylideneamino)-3-penta-1,3-dien-3-ylaniline (PubChem CID 123842837) has the molecular formula C18H26N2
and a molecular weight of 270.42 g/mol. Its IUPAC name is N-methyl-6-(2-methylbutan-2-yl)-2-(methylideneamino)-3-penta-1,3-dien-3-ylaniline.
Molecular Properties
| Compound Name | N-methyl-6-(2-methylbutan-2-yl)-2-(methylideneamino)-3-penta-1,3-dien-3-ylaniline |
| PubChem CID | 123842837 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | N-methyl-6-(2-methylbutan-2-yl)-2-(methylideneamino)-3-penta-1,3-dien-3-ylaniline |
| SMILES | C=CC(=CC)c1ccc(C(C)(C)CC)c(NC)c1N=C |
| InChI | InChI=1S/C18H26N2/c1-8-13(9-2)14-11-12-15(18(4,5)10-3)17(20-7)16(14)19-6/h8-9,11-12,20H,1,6,10H2,2-5,7H3 |
| InChIKey | JNRSFGVZZKEJGN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-6-(2-methylbutan-2-yl)-2-(methylideneamino)-3-penta-1,3-dien-3-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-6-(2-methylbutan-2-yl)-2-(methylideneamino)-3-penta-1,3-dien-3-ylaniline?
The IUPAC name of N-methyl-6-(2-methylbutan-2-yl)-2-(methylideneamino)-3-penta-1,3-dien-3-ylaniline (CID 123842837) is N-methyl-6-(2-methylbutan-2-yl)-2-(methylideneamino)-3-penta-1,3-dien-3-ylaniline.
What is the SMILES notation for N-methyl-6-(2-methylbutan-2-yl)-2-(methylideneamino)-3-penta-1,3-dien-3-ylaniline?
The canonical SMILES for N-methyl-6-(2-methylbutan-2-yl)-2-(methylideneamino)-3-penta-1,3-dien-3-ylaniline is C=CC(=CC)c1ccc(C(C)(C)CC)c(NC)c1N=C.
What is the InChIKey of N-methyl-6-(2-methylbutan-2-yl)-2-(methylideneamino)-3-penta-1,3-dien-3-ylaniline?
The InChIKey is JNRSFGVZZKEJGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2/c1-8-13(9-2)14-11-12-15(18(4,5)10-3)17(20-7)16(14)19-6/h8-9,11-12,20H,1,6,10H2,2-5,7H3.
What are the key properties of N-methyl-6-(2-methylbutan-2-yl)-2-(methylideneamino)-3-penta-1,3-dien-3-ylaniline?
N-methyl-6-(2-methylbutan-2-yl)-2-(methylideneamino)-3-penta-1,3-dien-3-ylaniline has a molecular weight of 270.42 g/mol, XLogP of 5.34, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-6-(2-methylbutan-2-yl)-2-(methylideneamino)-3-penta-1,3-dien-3-ylaniline is sourced from PubChem (CID 123842837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).