About 3-tert-butyl-5-ethyl-1,2-dimethyl-3H-pyrazole
3-tert-butyl-5-ethyl-1,2-dimethyl-3H-pyrazole (PubChem CID 123842943) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is 3-tert-butyl-5-ethyl-1,2-dimethyl-3H-pyrazole.
Molecular Properties
| Compound Name | 3-tert-butyl-5-ethyl-1,2-dimethyl-3H-pyrazole |
| PubChem CID | 123842943 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 3-tert-butyl-5-ethyl-1,2-dimethyl-3H-pyrazole |
| SMILES | CCC1=CC(C(C)(C)C)N(C)N1C |
| InChI | InChI=1S/C11H22N2/c1-7-9-8-10(11(2,3)4)13(6)12(9)5/h8,10H,7H2,1-6H3 |
| InChIKey | QPBPCFVCAZWSRF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-tert-butyl-5-ethyl-1,2-dimethyl-3H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-5-ethyl-1,2-dimethyl-3H-pyrazole?
The IUPAC name of 3-tert-butyl-5-ethyl-1,2-dimethyl-3H-pyrazole (CID 123842943) is 3-tert-butyl-5-ethyl-1,2-dimethyl-3H-pyrazole.
What is the SMILES notation for 3-tert-butyl-5-ethyl-1,2-dimethyl-3H-pyrazole?
The canonical SMILES for 3-tert-butyl-5-ethyl-1,2-dimethyl-3H-pyrazole is CCC1=CC(C(C)(C)C)N(C)N1C.
What is the InChIKey of 3-tert-butyl-5-ethyl-1,2-dimethyl-3H-pyrazole?
The InChIKey is QPBPCFVCAZWSRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2/c1-7-9-8-10(11(2,3)4)13(6)12(9)5/h8,10H,7H2,1-6H3.
What are the key properties of 3-tert-butyl-5-ethyl-1,2-dimethyl-3H-pyrazole?
3-tert-butyl-5-ethyl-1,2-dimethyl-3H-pyrazole has a molecular weight of 182.31 g/mol, XLogP of 2.49, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-5-ethyl-1,2-dimethyl-3H-pyrazole is sourced from PubChem (CID 123842943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).