C21H17F5N4O4 — CID 123843460
4-[amino-[[3-(difluoromethyl)-1-methyl-5-[3-(trifluoromethyl)phenoxy]pyrazole-4-carbonyl]amino]methyl]benzoic acid (PubChem CID 123843460) has the molecular formula C21H17F5N4O4 and a molecular weight of 484.38 g/mol. Its IUPAC name is 4-[amino-[[3-(difluoromethyl)-1-methyl-5-[3-(trifluoromethyl)phenoxy]pyrazole-4-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 4-[amino-[[3-(difluoromethyl)-1-methyl-5-[3-(trifluoromethyl)phenoxy]pyrazole-4-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 123843460 |
| Molecular Formula | C21H17F5N4O4 |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 4-[amino-[[3-(difluoromethyl)-1-methyl-5-[3-(trifluoromethyl)phenoxy]pyrazole-4-carbonyl]amino]methyl]benzoic acid |
| SMILES | Cn1nc(C(F)F)c(C(=O)NC(N)c2ccc(C(=O)O)cc2)c1Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H17F5N4O4/c1-30-19(34-13-4-2-3-12(9-13)21(24,25)26)14(15(29-30)16(22)23)18(31)28-17(27)10-5-7-11(8-6-10)20(32)33/h2-9,16-17H,27H2,1H3,(H,28,31)(H,32,33) |
| InChIKey | AVEXBXHSMNCOOX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|