C25H28FN4O3+ — CID 123843779
7-[5-(4-fluorophenyl)-7-propan-2-ylpyrrolo[1,2-a]imidazol-4-ium-2-carbonyl]-2-propan-2-yl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one (PubChem CID 123843779) has the molecular formula C25H28FN4O3+ and a molecular weight of 451.52 g/mol. Its IUPAC name is 7-[5-(4-fluorophenyl)-7-propan-2-ylpyrrolo[1,2-a]imidazol-4-ium-2-carbonyl]-2-propan-2-yl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one.
| Compound Name | 7-[5-(4-fluorophenyl)-7-propan-2-ylpyrrolo[1,2-a]imidazol-4-ium-2-carbonyl]-2-propan-2-yl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one |
|---|---|
| PubChem CID | 123843779 |
| Molecular Formula | C25H28FN4O3+ |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 7-[5-(4-fluorophenyl)-7-propan-2-ylpyrrolo[1,2-a]imidazol-4-ium-2-carbonyl]-2-propan-2-yl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one |
| SMILES | CC(C)C1=CC(c2ccc(F)cc2)=[N+]2C=C(C(=O)N3CCN4C(=O)C(C(C)C)OC4C3)N=C12 |
| InChI | InChI=1S/C25H28FN4O3/c1-14(2)18-11-20(16-5-7-17(26)8-6-16)30-12-19(27-23(18)30)24(31)28-9-10-29-21(13-28)33-22(15(3)4)25(29)32/h5-8,11-12,14-15,21-22H,9-10,13H2,1-4H3/q+1 |
| InChIKey | TZIULPKZEBKMGX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|