C28H21F2N7O2 — CID 123844146
3-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-[5-(difluoromethoxy)-3-pyridinyl]-2-phenylisoquinolin-1-one (PubChem CID 123844146) has the molecular formula C28H21F2N7O2 and a molecular weight of 525.52 g/mol. Its IUPAC name is 3-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-[5-(difluoromethoxy)-3-pyridinyl]-2-phenylisoquinolin-1-one.
| Compound Name | 3-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-[5-(difluoromethoxy)-3-pyridinyl]-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 123844146 |
| Molecular Formula | C28H21F2N7O2 |
| Molecular Weight | 525.52 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | 3-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-[5-(difluoromethoxy)-3-pyridinyl]-2-phenylisoquinolin-1-one |
| SMILES | [C-]#[N+]c1cnc(N)nc1N[C@@H](C)c1cc2cccc(-c3cncc(OC(F)F)c3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C28H21F2N7O2/c1-16(35-25-22(32-2)15-34-28(31)36-25)23-12-17-7-6-10-21(18-11-20(14-33-13-18)39-27(29)30)24(17)26(38)37(23)19-8-4-3-5-9-19/h3-16,27H,1H3,(H3,31,34,35,36)/t16-/m0/s1 |
| InChIKey | MKTBXCMIZHCEFT-INIZCTEOSA-N |
| XLogP | 5.75 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.52 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|