C30H44O6 — CID 123844276
8-ethyl-10-hydroxy-6,6,8,9-tetramethyl-5-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]-3-oxatricyclo[9.8.0.02,9]nonadec-1(11)-en-4-one (PubChem CID 123844276) has the molecular formula C30H44O6 and a molecular weight of 500.68 g/mol. Its IUPAC name is 8-ethyl-10-hydroxy-6,6,8,9-tetramethyl-5-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]-3-oxatricyclo[9.8.0.02,9]nonadec-1(11)-en-4-one.
| Compound Name | 8-ethyl-10-hydroxy-6,6,8,9-tetramethyl-5-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]-3-oxatricyclo[9.8.0.02,9]nonadec-1(11)-en-4-one |
|---|---|
| PubChem CID | 123844276 |
| Molecular Formula | C30H44O6 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | 8-ethyl-10-hydroxy-6,6,8,9-tetramethyl-5-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]-3-oxatricyclo[9.8.0.02,9]nonadec-1(11)-en-4-one |
| SMILES | CCC1(C)CC(C)(C)C(=COC2C=C(C)C(=O)O2)C(=O)OC2C3=C(CCCCCCCC3)C(O)C21C |
| InChI | InChI=1S/C30H44O6/c1-7-29(5)18-28(3,4)22(17-34-23-16-19(2)26(32)35-23)27(33)36-25-21-15-13-11-9-8-10-12-14-20(21)24(31)30(25,29)6/h16-17,23-25,31H,7-15,18H2,1-6H3 |
| InChIKey | KAGMMHXRSDJIOL-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|