C24H42N6O7S — CID 123844561
2-acetamido-N-[1-amino-3-[2,5-dihydroxy-1-[3-oxo-3-(propylamino)propyl]pyrrol-3-yl]sulfanyl-1-hydroxypropan-2-yl]-6-(propanoylamino)hexanamide (PubChem CID 123844561) has the molecular formula C24H42N6O7S and a molecular weight of 558.70 g/mol. Its IUPAC name is 2-acetamido-N-[1-amino-3-[2,5-dihydroxy-1-[3-oxo-3-(propylamino)propyl]pyrrol-3-yl]sulfanyl-1-hydroxypropan-2-yl]-6-(propanoylamino)hexanamide.
| Compound Name | 2-acetamido-N-[1-amino-3-[2,5-dihydroxy-1-[3-oxo-3-(propylamino)propyl]pyrrol-3-yl]sulfanyl-1-hydroxypropan-2-yl]-6-(propanoylamino)hexanamide |
|---|---|
| PubChem CID | 123844561 |
| Molecular Formula | C24H42N6O7S |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | 2-acetamido-N-[1-amino-3-[2,5-dihydroxy-1-[3-oxo-3-(propylamino)propyl]pyrrol-3-yl]sulfanyl-1-hydroxypropan-2-yl]-6-(propanoylamino)hexanamide |
| SMILES | CCCNC(=O)CCn1c(O)cc(SCC(NC(=O)C(CCCCNC(=O)CC)NC(C)=O)C(N)O)c1O |
| InChI | InChI=1S/C24H42N6O7S/c1-4-10-26-20(33)9-12-30-21(34)13-18(24(30)37)38-14-17(22(25)35)29-23(36)16(28-15(3)31)8-6-7-11-27-19(32)5-2/h13,16-17,22,34-35,37H,4-12,14,25H2,1-3H3,(H,26,33)(H,27,32)(H,28,31)(H,29,36) |
| InChIKey | RCDOURNCMQPRPO-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 208.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|