C21H28N2O3 — CID 123844845
N-hydroxy-6-(2,2,7-trimethyl-4-oxo-1,3-dihydrocarbazol-9-yl)hexanamide (PubChem CID 123844845) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-hydroxy-6-(2,2,7-trimethyl-4-oxo-1,3-dihydrocarbazol-9-yl)hexanamide.
| Compound Name | N-hydroxy-6-(2,2,7-trimethyl-4-oxo-1,3-dihydrocarbazol-9-yl)hexanamide |
|---|---|
| PubChem CID | 123844845 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | N-hydroxy-6-(2,2,7-trimethyl-4-oxo-1,3-dihydrocarbazol-9-yl)hexanamide |
| SMILES | Cc1ccc2c3c(n(CCCCCC(=O)NO)c2c1)CC(C)(C)CC3=O |
| InChI | InChI=1S/C21H28N2O3/c1-14-8-9-15-16(11-14)23(10-6-4-5-7-19(25)22-26)17-12-21(2,3)13-18(24)20(15)17/h8-9,11,26H,4-7,10,12-13H2,1-3H3,(H,22,25) |
| InChIKey | MSSFCXSTNFPLAS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|