C23H26Cl2N2O — CID 123845193
2-(5-chloro-2-methylindol-1-yl)-1-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]ethanol (PubChem CID 123845193) has the molecular formula C23H26Cl2N2O and a molecular weight of 417.38 g/mol. Its IUPAC name is 2-(5-chloro-2-methylindol-1-yl)-1-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]ethanol.
| Compound Name | 2-(5-chloro-2-methylindol-1-yl)-1-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]ethanol |
|---|---|
| PubChem CID | 123845193 |
| Molecular Formula | C23H26Cl2N2O |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 2-(5-chloro-2-methylindol-1-yl)-1-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]ethanol |
| SMILES | Cc1cc2cc(Cl)ccc2n1CC(O)C1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H26Cl2N2O/c1-16-12-19-13-21(25)6-7-22(19)27(16)15-23(28)18-8-10-26(11-9-18)14-17-2-4-20(24)5-3-17/h2-7,12-13,18,23,28H,8-11,14-15H2,1H3 |
| InChIKey | WLOHDIWOZMWHMJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |