About 2-fluoro-8-[(5-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-7H-purin-6-amine
2-fluoro-8-[(5-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-7H-purin-6-amine (PubChem CID 123845632) has the molecular formula C15H14FN5O
and a molecular weight of 299.31 g/mol. Its IUPAC name is 2-fluoro-8-[(5-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-7H-purin-6-amine.
Molecular Properties
| Compound Name | 2-fluoro-8-[(5-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-7H-purin-6-amine |
| PubChem CID | 123845632 |
| Molecular Formula | C15H14FN5O |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-fluoro-8-[(5-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-7H-purin-6-amine |
| SMILES | Cc1cc2c(cc1Cc1nc3nc(F)nc(N)c3[nH]1)OCC2 |
| InChI | InChI=1S/C15H14FN5O/c1-7-4-8-2-3-22-10(8)5-9(7)6-11-18-12-13(17)20-15(16)21-14(12)19-11/h4-5H,2-3,6H2,1H3,(H3,17,18,19,20,21) |
| InChIKey | GWAKLDBIWCIWMU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-fluoro-8-[(5-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-8-[(5-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-7H-purin-6-amine?
The IUPAC name of 2-fluoro-8-[(5-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-7H-purin-6-amine (CID 123845632) is 2-fluoro-8-[(5-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-7H-purin-6-amine.
What is the SMILES notation for 2-fluoro-8-[(5-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-7H-purin-6-amine?
The canonical SMILES for 2-fluoro-8-[(5-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-7H-purin-6-amine is Cc1cc2c(cc1Cc1nc3nc(F)nc(N)c3[nH]1)OCC2.
What is the InChIKey of 2-fluoro-8-[(5-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-7H-purin-6-amine?
The InChIKey is GWAKLDBIWCIWMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14FN5O/c1-7-4-8-2-3-22-10(8)5-9(7)6-11-18-12-13(17)20-15(16)21-14(12)19-11/h4-5H,2-3,6H2,1H3,(H3,17,18,19,20,21).
What are the key properties of 2-fluoro-8-[(5-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-7H-purin-6-amine?
2-fluoro-8-[(5-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-7H-purin-6-amine has a molecular weight of 299.31 g/mol, XLogP of 1.91, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-8-[(5-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-7H-purin-6-amine is sourced from PubChem (CID 123845632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).