About N-cyclopentyl-2-fluoro-4-methylidenecyclohexa-1,5-diene-1-carboxamide
N-cyclopentyl-2-fluoro-4-methylidenecyclohexa-1,5-diene-1-carboxamide (PubChem CID 123846307) has the molecular formula C13H16FNO
and a molecular weight of 221.27 g/mol. Its IUPAC name is N-cyclopentyl-2-fluoro-4-methylidenecyclohexa-1,5-diene-1-carboxamide.
Molecular Properties
| Compound Name | N-cyclopentyl-2-fluoro-4-methylidenecyclohexa-1,5-diene-1-carboxamide |
| PubChem CID | 123846307 |
| Molecular Formula | C13H16FNO |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N-cyclopentyl-2-fluoro-4-methylidenecyclohexa-1,5-diene-1-carboxamide |
| SMILES | C=C1C=CC(C(=O)NC2CCCC2)=C(F)C1 |
| InChI | InChI=1S/C13H16FNO/c1-9-6-7-11(12(14)8-9)13(16)15-10-4-2-3-5-10/h6-7,10H,1-5,8H2,(H,15,16) |
| InChIKey | NYKMNSLVHWGEQG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclopentyl-2-fluoro-4-methylidenecyclohexa-1,5-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-2-fluoro-4-methylidenecyclohexa-1,5-diene-1-carboxamide?
The IUPAC name of N-cyclopentyl-2-fluoro-4-methylidenecyclohexa-1,5-diene-1-carboxamide (CID 123846307) is N-cyclopentyl-2-fluoro-4-methylidenecyclohexa-1,5-diene-1-carboxamide.
What is the SMILES notation for N-cyclopentyl-2-fluoro-4-methylidenecyclohexa-1,5-diene-1-carboxamide?
The canonical SMILES for N-cyclopentyl-2-fluoro-4-methylidenecyclohexa-1,5-diene-1-carboxamide is C=C1C=CC(C(=O)NC2CCCC2)=C(F)C1.
What is the InChIKey of N-cyclopentyl-2-fluoro-4-methylidenecyclohexa-1,5-diene-1-carboxamide?
The InChIKey is NYKMNSLVHWGEQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16FNO/c1-9-6-7-11(12(14)8-9)13(16)15-10-4-2-3-5-10/h6-7,10H,1-5,8H2,(H,15,16).
What are the key properties of N-cyclopentyl-2-fluoro-4-methylidenecyclohexa-1,5-diene-1-carboxamide?
N-cyclopentyl-2-fluoro-4-methylidenecyclohexa-1,5-diene-1-carboxamide has a molecular weight of 221.27 g/mol, XLogP of 2.78, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-2-fluoro-4-methylidenecyclohexa-1,5-diene-1-carboxamide is sourced from PubChem (CID 123846307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).