C30H31F5O3 — CID 123847162
(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-11-[4-(3-oxobut-1-enyl)phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 123847162) has the molecular formula C30H31F5O3 and a molecular weight of 534.57 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-11-[4-(3-oxobut-1-enyl)phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-11-[4-(3-oxobut-1-enyl)phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 123847162 |
| Molecular Formula | C30H31F5O3 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | (8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-11-[4-(3-oxobut-1-enyl)phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)C=Cc1ccc([C@H]2C[C@@]3(C)[C@@H](CC[C@@]3(O)C(F)(F)C(F)(F)F)[C@@H]3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C30H31F5O3/c1-17(36)3-4-18-5-7-19(8-6-18)24-16-27(2)25(13-14-28(27,38)29(31,32)30(33,34)35)23-11-9-20-15-21(37)10-12-22(20)26(23)24/h3-8,15,23-25,38H,9-14,16H2,1-2H3/t23-,24+,25-,27-,28-/m0/s1 |
| InChIKey | GWVSMVZSBXSLMU-WKWWZUSTSA-N |
| XLogP | 7.12 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|