C31H39N7O5SSi — CID 123847190
N-[3-[[5-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]anilino]pyrimidin-4-yl]-2-pyridinyl]amino]propyl]-2-nitrobenzenesulfonamide (PubChem CID 123847190) has the molecular formula C31H39N7O5SSi and a molecular weight of 649.85 g/mol. Its IUPAC name is N-[3-[[5-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]anilino]pyrimidin-4-yl]-2-pyridinyl]amino]propyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[3-[[5-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]anilino]pyrimidin-4-yl]-2-pyridinyl]amino]propyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 123847190 |
| Molecular Formula | C31H39N7O5SSi |
| Molecular Weight | 649.85 g/mol |
| Exact Mass | 649.25 |
| IUPAC Name | N-[3-[[5-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]anilino]pyrimidin-4-yl]-2-pyridinyl]amino]propyl]-2-nitrobenzenesulfonamide |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cccc(Nc2nccc(-c3ccc(NCCCNS(=O)(=O)c4ccccc4[N+](=O)[O-])nc3)n2)c1 |
| InChI | InChI=1S/C31H39N7O5SSi/c1-31(2,3)45(4,5)43-22-23-10-8-11-25(20-23)36-30-33-19-16-26(37-30)24-14-15-29(34-21-24)32-17-9-18-35-44(41,42)28-13-7-6-12-27(28)38(39)40/h6-8,10-16,19-21,35H,9,17-18,22H2,1-5H3,(H,32,34)(H,33,36,37) |
| InChIKey | YDGBEMGWQBRJHK-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 161.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.85 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|