C25H40N2O2 — CID 123848329
4-[1,1-dimethyl-4-[(1H-pyrrol-2-ylmethylamino)methyl]-2,3,4,5,6,7-hexahydroinden-5-yl]-3-(hydroxymethyl)-4-methylcyclohexan-1-ol (PubChem CID 123848329) has the molecular formula C25H40N2O2 and a molecular weight of 400.61 g/mol. Its IUPAC name is 4-[1,1-dimethyl-4-[(1H-pyrrol-2-ylmethylamino)methyl]-2,3,4,5,6,7-hexahydroinden-5-yl]-3-(hydroxymethyl)-4-methylcyclohexan-1-ol.
| Compound Name | 4-[1,1-dimethyl-4-[(1H-pyrrol-2-ylmethylamino)methyl]-2,3,4,5,6,7-hexahydroinden-5-yl]-3-(hydroxymethyl)-4-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 123848329 |
| Molecular Formula | C25H40N2O2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.31 |
| IUPAC Name | 4-[1,1-dimethyl-4-[(1H-pyrrol-2-ylmethylamino)methyl]-2,3,4,5,6,7-hexahydroinden-5-yl]-3-(hydroxymethyl)-4-methylcyclohexan-1-ol |
| SMILES | CC1(C)CCC2=C1CCC(C1(C)CCC(O)CC1CO)C2CNCc1ccc[nH]1 |
| InChI | InChI=1S/C25H40N2O2/c1-24(2)10-9-20-21(15-26-14-18-5-4-12-27-18)23(7-6-22(20)24)25(3)11-8-19(29)13-17(25)16-28/h4-5,12,17,19,21,23,26-29H,6-11,13-16H2,1-3H3 |
| InChIKey | TUKLLXZQUDLMOY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|