C34H49NO2 — CID 123848646
5-[6-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]cyclodecyl]pentanoic acid (PubChem CID 123848646) has the molecular formula C34H49NO2 and a molecular weight of 503.77 g/mol. Its IUPAC name is 5-[6-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]cyclodecyl]pentanoic acid.
| Compound Name | 5-[6-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]cyclodecyl]pentanoic acid |
|---|---|
| PubChem CID | 123848646 |
| Molecular Formula | C34H49NO2 |
| Molecular Weight | 503.77 g/mol |
| Exact Mass | 503.38 |
| IUPAC Name | 5-[6-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]cyclodecyl]pentanoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3cccc(C4CCCCC(CCCCC(=O)O)CCCC4)n3)ccc21 |
| InChI | InChI=1S/C34H49NO2/c1-33(2)22-23-34(3,4)29-24-27(20-21-28(29)33)31-18-11-17-30(35-31)26-15-8-5-12-25(13-6-9-16-26)14-7-10-19-32(36)37/h11,17-18,20-21,24-26H,5-10,12-16,19,22-23H2,1-4H3,(H,36,37) |
| InChIKey | FYFBZWGASMVGDI-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.77 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|