About 6-but-2-en-2-yl-7-fluoro-1,5-dimethyl-2,3-dihydroazepine
6-but-2-en-2-yl-7-fluoro-1,5-dimethyl-2,3-dihydroazepine (PubChem CID 123848985) has the molecular formula C12H18FN
and a molecular weight of 195.28 g/mol. Its IUPAC name is 6-but-2-en-2-yl-7-fluoro-1,5-dimethyl-2,3-dihydroazepine.
Molecular Properties
| Compound Name | 6-but-2-en-2-yl-7-fluoro-1,5-dimethyl-2,3-dihydroazepine |
| PubChem CID | 123848985 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 6-but-2-en-2-yl-7-fluoro-1,5-dimethyl-2,3-dihydroazepine |
| SMILES | CC=C(C)C1=C(F)N(C)CCC=C1C |
| InChI | InChI=1S/C12H18FN/c1-5-9(2)11-10(3)7-6-8-14(4)12(11)13/h5,7H,6,8H2,1-4H3 |
| InChIKey | LCXITQDTYIZGKT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-but-2-en-2-yl-7-fluoro-1,5-dimethyl-2,3-dihydroazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-but-2-en-2-yl-7-fluoro-1,5-dimethyl-2,3-dihydroazepine?
The IUPAC name of 6-but-2-en-2-yl-7-fluoro-1,5-dimethyl-2,3-dihydroazepine (CID 123848985) is 6-but-2-en-2-yl-7-fluoro-1,5-dimethyl-2,3-dihydroazepine.
What is the SMILES notation for 6-but-2-en-2-yl-7-fluoro-1,5-dimethyl-2,3-dihydroazepine?
The canonical SMILES for 6-but-2-en-2-yl-7-fluoro-1,5-dimethyl-2,3-dihydroazepine is CC=C(C)C1=C(F)N(C)CCC=C1C.
What is the InChIKey of 6-but-2-en-2-yl-7-fluoro-1,5-dimethyl-2,3-dihydroazepine?
The InChIKey is LCXITQDTYIZGKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18FN/c1-5-9(2)11-10(3)7-6-8-14(4)12(11)13/h5,7H,6,8H2,1-4H3.
What are the key properties of 6-but-2-en-2-yl-7-fluoro-1,5-dimethyl-2,3-dihydroazepine?
6-but-2-en-2-yl-7-fluoro-1,5-dimethyl-2,3-dihydroazepine has a molecular weight of 195.28 g/mol, XLogP of 3.42, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-but-2-en-2-yl-7-fluoro-1,5-dimethyl-2,3-dihydroazepine is sourced from PubChem (CID 123848985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).