C39H40ClN5O3S — CID 123849027
3-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-methyl-7-(1,3,5-trimethylpyrazol-4-yl)indol-1-yl]methyl]-N-pyridin-3-ylsulfinylbenzamide (PubChem CID 123849027) has the molecular formula C39H40ClN5O3S and a molecular weight of 694.30 g/mol. Its IUPAC name is 3-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-methyl-7-(1,3,5-trimethylpyrazol-4-yl)indol-1-yl]methyl]-N-pyridin-3-ylsulfinylbenzamide.
| Compound Name | 3-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-methyl-7-(1,3,5-trimethylpyrazol-4-yl)indol-1-yl]methyl]-N-pyridin-3-ylsulfinylbenzamide |
|---|---|
| PubChem CID | 123849027 |
| Molecular Formula | C39H40ClN5O3S |
| Molecular Weight | 694.30 g/mol |
| Exact Mass | 693.25 |
| IUPAC Name | 3-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-methyl-7-(1,3,5-trimethylpyrazol-4-yl)indol-1-yl]methyl]-N-pyridin-3-ylsulfinylbenzamide |
| SMILES | Cc1cc(OCCCc2c(C)n(Cc3cccc(C(=O)NS(=O)c4cccnc4)c3)c3c(-c4c(C)nn(C)c4C)cccc23)cc(C)c1Cl |
| InChI | InChI=1S/C39H40ClN5O3S/c1-24-19-31(20-25(2)37(24)40)48-18-10-16-33-27(4)45(38-34(33)14-8-15-35(38)36-26(3)42-44(6)28(36)5)23-29-11-7-12-30(21-29)39(46)43-49(47)32-13-9-17-41-22-32/h7-9,11-15,17,19-22H,10,16,18,23H2,1-6H3,(H,43,46) |
| InChIKey | AMKXAOWAAIEGSP-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.30 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|