About 7-amino-2,3-dimethylimidazo[1,2-a]pyrimidine-6-carboxamide
7-amino-2,3-dimethylimidazo[1,2-a]pyrimidine-6-carboxamide (PubChem CID 123849245) has the molecular formula C9H11N5O
and a molecular weight of 205.22 g/mol. Its IUPAC name is 7-amino-2,3-dimethylimidazo[1,2-a]pyrimidine-6-carboxamide.
Molecular Properties
| Compound Name | 7-amino-2,3-dimethylimidazo[1,2-a]pyrimidine-6-carboxamide |
| PubChem CID | 123849245 |
| Molecular Formula | C9H11N5O |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 7-amino-2,3-dimethylimidazo[1,2-a]pyrimidine-6-carboxamide |
| SMILES | Cc1nc2nc(N)c(C(N)=O)cn2c1C |
| InChI | InChI=1S/C9H11N5O/c1-4-5(2)14-3-6(8(11)15)7(10)13-9(14)12-4/h3H,1-2H3,(H2,11,15)(H2,10,12,13) |
| InChIKey | UUJHYUUYEKSEDX-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 99.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-amino-2,3-dimethylimidazo[1,2-a]pyrimidine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-2,3-dimethylimidazo[1,2-a]pyrimidine-6-carboxamide?
The IUPAC name of 7-amino-2,3-dimethylimidazo[1,2-a]pyrimidine-6-carboxamide (CID 123849245) is 7-amino-2,3-dimethylimidazo[1,2-a]pyrimidine-6-carboxamide.
What is the SMILES notation for 7-amino-2,3-dimethylimidazo[1,2-a]pyrimidine-6-carboxamide?
The canonical SMILES for 7-amino-2,3-dimethylimidazo[1,2-a]pyrimidine-6-carboxamide is Cc1nc2nc(N)c(C(N)=O)cn2c1C.
What is the InChIKey of 7-amino-2,3-dimethylimidazo[1,2-a]pyrimidine-6-carboxamide?
The InChIKey is UUJHYUUYEKSEDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5O/c1-4-5(2)14-3-6(8(11)15)7(10)13-9(14)12-4/h3H,1-2H3,(H2,11,15)(H2,10,12,13).
What are the key properties of 7-amino-2,3-dimethylimidazo[1,2-a]pyrimidine-6-carboxamide?
7-amino-2,3-dimethylimidazo[1,2-a]pyrimidine-6-carboxamide has a molecular weight of 205.22 g/mol, XLogP of 0.03, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-2,3-dimethylimidazo[1,2-a]pyrimidine-6-carboxamide is sourced from PubChem (CID 123849245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).