C17H25FN2O — CID 123849951
4-ethyl-2-fluoro-N-(3-piperidin-1-ylpropyl)benzamide (PubChem CID 123849951) has the molecular formula C17H25FN2O and a molecular weight of 292.40 g/mol. Its IUPAC name is 4-ethyl-2-fluoro-N-(3-piperidin-1-ylpropyl)benzamide.
| Compound Name | 4-ethyl-2-fluoro-N-(3-piperidin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 123849951 |
| Molecular Formula | C17H25FN2O |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 4-ethyl-2-fluoro-N-(3-piperidin-1-ylpropyl)benzamide |
| SMILES | CCc1ccc(C(=O)NCCCN2CCCCC2)c(F)c1 |
| InChI | InChI=1S/C17H25FN2O/c1-2-14-7-8-15(16(18)13-14)17(21)19-9-6-12-20-10-4-3-5-11-20/h7-8,13H,2-6,9-12H2,1H3,(H,19,21) |
| InChIKey | YYWCNADCFBAQDR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|