C20H15BF2N2OS — CID 123851157
2,2-difluoro-12-(4-methoxyphenyl)-4-thiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 123851157) has the molecular formula C20H15BF2N2OS and a molecular weight of 380.23 g/mol. Its IUPAC name is 2,2-difluoro-12-(4-methoxyphenyl)-4-thiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-12-(4-methoxyphenyl)-4-thiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 123851157 |
| Molecular Formula | C20H15BF2N2OS |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 2,2-difluoro-12-(4-methoxyphenyl)-4-thiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | COc1ccc(C2=[N+]3C(=Cc4ccc(-c5cccs5)n4[B-]3(F)F)C=C2)cc1 |
| InChI | InChI=1S/C20H15BF2N2OS/c1-26-17-8-4-14(5-9-17)18-10-6-15-13-16-7-11-19(20-3-2-12-27-20)25(16)21(22,23)24(15)18/h2-13H,1H3 |
| InChIKey | JUIHAIRHFKAJCC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 17.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|