C26H43F2N7O2 — CID 123851475
3,3-diamino-2-(3-fluoro-5-azatricyclo[3.3.2.21,4]dodecan-10-yl)-N-[5-fluoro-4-(4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide (PubChem CID 123851475) has the molecular formula C26H43F2N7O2 and a molecular weight of 523.67 g/mol. Its IUPAC name is 3,3-diamino-2-(3-fluoro-5-azatricyclo[3.3.2.21,4]dodecan-10-yl)-N-[5-fluoro-4-(4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(3-fluoro-5-azatricyclo[3.3.2.21,4]dodecan-10-yl)-N-[5-fluoro-4-(4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 123851475 |
| Molecular Formula | C26H43F2N7O2 |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.34 |
| IUPAC Name | 3,3-diamino-2-(3-fluoro-5-azatricyclo[3.3.2.21,4]dodecan-10-yl)-N-[5-fluoro-4-(4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide |
| SMILES | NC(N)C(C(=O)NC1CNCC(F)C1N1CC(=O)N2CCCC2C1)C1CC23CCCN1C(CC2)C(F)C3 |
| InChI | InChI=1S/C26H43F2N7O2/c27-16-9-26-5-2-8-35(19(16)4-6-26)20(10-26)22(24(29)30)25(37)32-18-12-31-11-17(28)23(18)33-13-15-3-1-7-34(15)21(36)14-33/h15-20,22-24,31H,1-14,29-30H2,(H,32,37) |
| InChIKey | DMZYSSAXROWIBY-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 119.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|