About 3-(chloromethyl)-2,2,4-trimethyl-1-(2-methylbutan-2-yloxy)pentane
3-(chloromethyl)-2,2,4-trimethyl-1-(2-methylbutan-2-yloxy)pentane (PubChem CID 123851489) has the molecular formula C14H29ClO
and a molecular weight of 248.84 g/mol. Its IUPAC name is 3-(chloromethyl)-2,2,4-trimethyl-1-(2-methylbutan-2-yloxy)pentane.
Molecular Properties
| Compound Name | 3-(chloromethyl)-2,2,4-trimethyl-1-(2-methylbutan-2-yloxy)pentane |
| PubChem CID | 123851489 |
| Molecular Formula | C14H29ClO |
| Molecular Weight | 248.84 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 3-(chloromethyl)-2,2,4-trimethyl-1-(2-methylbutan-2-yloxy)pentane |
| SMILES | CCC(C)(C)OCC(C)(C)C(CCl)C(C)C |
| InChI | InChI=1S/C14H29ClO/c1-8-14(6,7)16-10-13(4,5)12(9-15)11(2)3/h11-12H,8-10H2,1-7H3 |
| InChIKey | KIYDYLNLMPUERX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.84 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethyl)-2,2,4-trimethyl-1-(2-methylbutan-2-yloxy)pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethyl)-2,2,4-trimethyl-1-(2-methylbutan-2-yloxy)pentane?
The IUPAC name of 3-(chloromethyl)-2,2,4-trimethyl-1-(2-methylbutan-2-yloxy)pentane (CID 123851489) is 3-(chloromethyl)-2,2,4-trimethyl-1-(2-methylbutan-2-yloxy)pentane.
What is the SMILES notation for 3-(chloromethyl)-2,2,4-trimethyl-1-(2-methylbutan-2-yloxy)pentane?
The canonical SMILES for 3-(chloromethyl)-2,2,4-trimethyl-1-(2-methylbutan-2-yloxy)pentane is CCC(C)(C)OCC(C)(C)C(CCl)C(C)C.
What is the InChIKey of 3-(chloromethyl)-2,2,4-trimethyl-1-(2-methylbutan-2-yloxy)pentane?
The InChIKey is KIYDYLNLMPUERX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29ClO/c1-8-14(6,7)16-10-13(4,5)12(9-15)11(2)3/h11-12H,8-10H2,1-7H3.
What are the key properties of 3-(chloromethyl)-2,2,4-trimethyl-1-(2-methylbutan-2-yloxy)pentane?
3-(chloromethyl)-2,2,4-trimethyl-1-(2-methylbutan-2-yloxy)pentane has a molecular weight of 248.84 g/mol, XLogP of 4.73, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)-2,2,4-trimethyl-1-(2-methylbutan-2-yloxy)pentane is sourced from PubChem (CID 123851489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).