About 2-(4-ethylphenyl)-1,1-dimethylpyrrolidin-1-ium
2-(4-ethylphenyl)-1,1-dimethylpyrrolidin-1-ium (PubChem CID 123851961) has the molecular formula C14H22N+
and a molecular weight of 204.34 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-1,1-dimethylpyrrolidin-1-ium.
Molecular Properties
| Compound Name | 2-(4-ethylphenyl)-1,1-dimethylpyrrolidin-1-ium |
| PubChem CID | 123851961 |
| Molecular Formula | C14H22N+ |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | 2-(4-ethylphenyl)-1,1-dimethylpyrrolidin-1-ium |
| SMILES | CCc1ccc(C2CCC[N+]2(C)C)cc1 |
| InChI | InChI=1S/C14H22N/c1-4-12-7-9-13(10-8-12)14-6-5-11-15(14,2)3/h7-10,14H,4-6,11H2,1-3H3/q+1 |
| InChIKey | VCSXJWGHYOBGEI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-ethylphenyl)-1,1-dimethylpyrrolidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethylphenyl)-1,1-dimethylpyrrolidin-1-ium?
The IUPAC name of 2-(4-ethylphenyl)-1,1-dimethylpyrrolidin-1-ium (CID 123851961) is 2-(4-ethylphenyl)-1,1-dimethylpyrrolidin-1-ium.
What is the SMILES notation for 2-(4-ethylphenyl)-1,1-dimethylpyrrolidin-1-ium?
The canonical SMILES for 2-(4-ethylphenyl)-1,1-dimethylpyrrolidin-1-ium is CCc1ccc(C2CCC[N+]2(C)C)cc1.
What is the InChIKey of 2-(4-ethylphenyl)-1,1-dimethylpyrrolidin-1-ium?
The InChIKey is VCSXJWGHYOBGEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N/c1-4-12-7-9-13(10-8-12)14-6-5-11-15(14,2)3/h7-10,14H,4-6,11H2,1-3H3/q+1.
What are the key properties of 2-(4-ethylphenyl)-1,1-dimethylpyrrolidin-1-ium?
2-(4-ethylphenyl)-1,1-dimethylpyrrolidin-1-ium has a molecular weight of 204.34 g/mol, XLogP of 3.16, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethylphenyl)-1,1-dimethylpyrrolidin-1-ium is sourced from PubChem (CID 123851961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).