About 4-[3-[amino(dihydroxy)-λ4-sulfanyl]phenyl]-7-fluoro-2-methylisoquinolin-1-one
4-[3-[amino(dihydroxy)-λ4-sulfanyl]phenyl]-7-fluoro-2-methylisoquinolin-1-one (PubChem CID 123852144) has the molecular formula C16H15FN2O3S
and a molecular weight of 334.37 g/mol. Its IUPAC name is 4-[3-[amino(dihydroxy)-λ4-sulfanyl]phenyl]-7-fluoro-2-methylisoquinolin-1-one.
Molecular Properties
| Compound Name | 4-[3-[amino(dihydroxy)-λ4-sulfanyl]phenyl]-7-fluoro-2-methylisoquinolin-1-one |
| PubChem CID | 123852144 |
| Molecular Formula | C16H15FN2O3S |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 4-[3-[amino(dihydroxy)-λ4-sulfanyl]phenyl]-7-fluoro-2-methylisoquinolin-1-one |
| SMILES | Cn1cc(-c2cccc(S(N)(O)O)c2)c2ccc(F)cc2c1=O |
| InChI | InChI=1S/C16H15FN2O3S/c1-19-9-15(10-3-2-4-12(7-10)23(18,21)22)13-6-5-11(17)8-14(13)16(19)20/h2-9,21-22H,18H2,1H3 |
| InChIKey | SPPSEPOQGLTVEZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[3-[amino(dihydroxy)-λ4-sulfanyl]phenyl]-7-fluoro-2-methylisoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[amino(dihydroxy)-λ4-sulfanyl]phenyl]-7-fluoro-2-methylisoquinolin-1-one?
The IUPAC name of 4-[3-[amino(dihydroxy)-λ4-sulfanyl]phenyl]-7-fluoro-2-methylisoquinolin-1-one (CID 123852144) is 4-[3-[amino(dihydroxy)-λ4-sulfanyl]phenyl]-7-fluoro-2-methylisoquinolin-1-one.
What is the SMILES notation for 4-[3-[amino(dihydroxy)-λ4-sulfanyl]phenyl]-7-fluoro-2-methylisoquinolin-1-one?
The canonical SMILES for 4-[3-[amino(dihydroxy)-λ4-sulfanyl]phenyl]-7-fluoro-2-methylisoquinolin-1-one is Cn1cc(-c2cccc(S(N)(O)O)c2)c2ccc(F)cc2c1=O.
What is the InChIKey of 4-[3-[amino(dihydroxy)-λ4-sulfanyl]phenyl]-7-fluoro-2-methylisoquinolin-1-one?
The InChIKey is SPPSEPOQGLTVEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15FN2O3S/c1-19-9-15(10-3-2-4-12(7-10)23(18,21)22)13-6-5-11(17)8-14(13)16(19)20/h2-9,21-22H,18H2,1H3.
What are the key properties of 4-[3-[amino(dihydroxy)-λ4-sulfanyl]phenyl]-7-fluoro-2-methylisoquinolin-1-one?
4-[3-[amino(dihydroxy)-λ4-sulfanyl]phenyl]-7-fluoro-2-methylisoquinolin-1-one has a molecular weight of 334.37 g/mol, XLogP of 3.33, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[amino(dihydroxy)-λ4-sulfanyl]phenyl]-7-fluoro-2-methylisoquinolin-1-one is sourced from PubChem (CID 123852144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).