C80H145N3O5 — CID 123852821
N-[8-(3,6-dihexyl-2-octylcyclohexyl)octyl]-N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dihydroxypyrrol-3-yl]acetamide (PubChem CID 123852821) has the molecular formula C80H145N3O5 and a molecular weight of 1229.06 g/mol. Its IUPAC name is N-[8-(3,6-dihexyl-2-octylcyclohexyl)octyl]-N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dihydroxypyrrol-3-yl]acetamide.
| Compound Name | N-[8-(3,6-dihexyl-2-octylcyclohexyl)octyl]-N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dihydroxypyrrol-3-yl]acetamide |
|---|---|
| PubChem CID | 123852821 |
| Molecular Formula | C80H145N3O5 |
| Molecular Weight | 1229.06 g/mol |
| Exact Mass | 1228.12 |
| IUPAC Name | N-[8-(3,6-dihexyl-2-octylcyclohexyl)octyl]-N-[1-[8-[6-[8-(2,5-dioxopyrrol-1-yl)octyl]-3-hexyl-2-octylcyclohexyl]octyl]-2,5-dihydroxypyrrol-3-yl]acetamide |
| SMILES | CCCCCCCCC1C(CCCCCC)CCC(CCCCCC)C1CCCCCCCCN(C(C)=O)c1cc(O)n(CCCCCCCCC2C(CCCCCCCCN3C(=O)C=CC3=O)CCC(CCCCCC)C2CCCCCCCC)c1O |
| InChI | InChI=1S/C80H145N3O5/c1-7-12-17-22-31-42-53-72-68(49-38-19-14-9-3)57-58-69(50-39-20-15-10-4)74(72)55-44-33-25-28-35-46-63-81(67(6)84)76-66-79(87)83(80(76)88)65-48-37-29-26-34-45-56-75-71(52-41-30-24-27-36-47-64-82-77(85)61-62-78(82)86)60-59-70(51-40-21-16-11-5)73(75)54-43-32-23-18-13-8-2/h61-62,66,68-75,87-88H,7-60,63-65H2,1-6H3 |
| InChIKey | DVYWFEJETOEMQT-UHFFFAOYSA-N |
| XLogP | 24.30 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 57 |
| Heavy Atoms | 88 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1229.06 |
| LogP ≤ 5 | 24.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|