C11H24O6S2 — CID 123852854
2-hexyl-3-methylbutane-1,4-disulfonic acid (PubChem CID 123852854) has the molecular formula C11H24O6S2 and a molecular weight of 316.44 g/mol. Its IUPAC name is 2-hexyl-3-methylbutane-1,4-disulfonic acid.
| Compound Name | 2-hexyl-3-methylbutane-1,4-disulfonic acid |
|---|---|
| PubChem CID | 123852854 |
| Molecular Formula | C11H24O6S2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 2-hexyl-3-methylbutane-1,4-disulfonic acid |
| SMILES | CCCCCCC(CS(=O)(=O)O)C(C)CS(=O)(=O)O |
| InChI | InChI=1S/C11H24O6S2/c1-3-4-5-6-7-11(9-19(15,16)17)10(2)8-18(12,13)14/h10-11H,3-9H2,1-2H3,(H,12,13,14)(H,15,16,17) |
| InChIKey | NWHAWKGCJLMYAI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|