C14H22N2 — CID 123852907
(Z)-2-ethyl-N-[(2Z)-6-(methylideneamino)hepta-2,5-dien-2-yl]but-2-en-1-imine (PubChem CID 123852907) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is (Z)-2-ethyl-N-[(2Z)-6-(methylideneamino)hepta-2,5-dien-2-yl]but-2-en-1-imine.
| Compound Name | (Z)-2-ethyl-N-[(2Z)-6-(methylideneamino)hepta-2,5-dien-2-yl]but-2-en-1-imine |
|---|---|
| PubChem CID | 123852907 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | (Z)-2-ethyl-N-[(2Z)-6-(methylideneamino)hepta-2,5-dien-2-yl]but-2-en-1-imine |
| SMILES | C=NC(C)=CC/C=C(C)\N=C\C(=C/C)CC |
| InChI | InChI=1S/C14H22N2/c1-6-14(7-2)11-16-13(4)10-8-9-12(3)15-5/h6,9-11H,5,7-8H2,1-4H3/b12-9?,13-10-,14-6-,16-11+ |
| InChIKey | FXEZLVDFSNBNOG-MLBIWAPBSA-N |
| XLogP | 4.31 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|