2-[5-(2,5-diaminopentanoylamino)-2-methoxyanilino]acetic acid

C14H22N4O4 — CID 123852911

IUPAC2-[5-(2,5-diaminopentanoylamino)-2-methoxyanilino]acetic acid
SMILESCOc1ccc(NC(=O)C(N)CCCN)cc1NCC(=O)O
InChIInChI=1S/C14H22N4O4/c1-22-12-5-4-9(7-11(12)17-8-13(19)20)18-14(21)10(16)3-2-6-15/h4-5,7,10,17H,2-3,6,8,15-16H2,1H3,(H,18,21)(H,19,20)
InChIKeyABROKSHZGWTZQT-UHFFFAOYSA-N
MW310.35 g/mol
LogP0.20
Rot. Bonds9

About 2-[5-(2,5-diaminopentanoylamino)-2-methoxyanilino]acetic acid

2-[5-(2,5-diaminopentanoylamino)-2-methoxyanilino]acetic acid (PubChem CID 123852911) has the molecular formula C14H22N4O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is 2-[5-(2,5-diaminopentanoylamino)-2-methoxyanilino]acetic acid.

Molecular Properties

Compound Name2-[5-(2,5-diaminopentanoylamino)-2-methoxyanilino]acetic acid
PubChem CID123852911
Molecular FormulaC14H22N4O4
Molecular Weight310.35 g/mol
Exact Mass310.16
IUPAC Name2-[5-(2,5-diaminopentanoylamino)-2-methoxyanilino]acetic acid
SMILESCOc1ccc(NC(=O)C(N)CCCN)cc1NCC(=O)O
InChIInChI=1S/C14H22N4O4/c1-22-12-5-4-9(7-11(12)17-8-13(19)20)18-14(21)10(16)3-2-6-15/h4-5,7,10,17H,2-3,6,8,15-16H2,1H3,(H,18,21)(H,19,20)
InChIKeyABROKSHZGWTZQT-UHFFFAOYSA-N
XLogP0.20
TPSA139.70 Ų
H-Bond Donors5
H-Bond Acceptors6
Rotatable Bonds9
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500310.35
LogP ≤ 50.20
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 106

Analyze 2-[5-(2,5-diaminopentanoylamino)-2-methoxyanilino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Frequently Asked Questions

What is the IUPAC name of 2-[5-(2,5-diaminopentanoylamino)-2-methoxyanilino]acetic acid?
The IUPAC name of 2-[5-(2,5-diaminopentanoylamino)-2-methoxyanilino]acetic acid (CID 123852911) is 2-[5-(2,5-diaminopentanoylamino)-2-methoxyanilino]acetic acid.
What is the SMILES notation for 2-[5-(2,5-diaminopentanoylamino)-2-methoxyanilino]acetic acid?
The canonical SMILES for 2-[5-(2,5-diaminopentanoylamino)-2-methoxyanilino]acetic acid is COc1ccc(NC(=O)C(N)CCCN)cc1NCC(=O)O.
What is the InChIKey of 2-[5-(2,5-diaminopentanoylamino)-2-methoxyanilino]acetic acid?
The InChIKey is ABROKSHZGWTZQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4O4/c1-22-12-5-4-9(7-11(12)17-8-13(19)20)18-14(21)10(16)3-2-6-15/h4-5,7,10,17H,2-3,6,8,15-16H2,1H3,(H,18,21)(H,19,20).
What are the key properties of 2-[5-(2,5-diaminopentanoylamino)-2-methoxyanilino]acetic acid?
2-[5-(2,5-diaminopentanoylamino)-2-methoxyanilino]acetic acid has a molecular weight of 310.35 g/mol, XLogP of 0.20, 9 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2,5-diaminopentanoylamino)-2-methoxyanilino]acetic acid is sourced from PubChem (CID 123852911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).