C14H22N4O4 — CID 123852911
2-[5-(2,5-diaminopentanoylamino)-2-methoxyanilino]acetic acid (PubChem CID 123852911) has the molecular formula C14H22N4O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is 2-[5-(2,5-diaminopentanoylamino)-2-methoxyanilino]acetic acid.
| Compound Name | 2-[5-(2,5-diaminopentanoylamino)-2-methoxyanilino]acetic acid |
|---|---|
| PubChem CID | 123852911 |
| Molecular Formula | C14H22N4O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 2-[5-(2,5-diaminopentanoylamino)-2-methoxyanilino]acetic acid |
| SMILES | COc1ccc(NC(=O)C(N)CCCN)cc1NCC(=O)O |
| InChI | InChI=1S/C14H22N4O4/c1-22-12-5-4-9(7-11(12)17-8-13(19)20)18-14(21)10(16)3-2-6-15/h4-5,7,10,17H,2-3,6,8,15-16H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | ABROKSHZGWTZQT-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 139.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |