C22H42N4 — CID 123853107
1-(1-piperidin-1-yl-3,4-dipyrrolidin-1-ylbutan-2-yl)piperidine (PubChem CID 123853107) has the molecular formula C22H42N4 and a molecular weight of 362.61 g/mol. Its IUPAC name is 1-(1-piperidin-1-yl-3,4-dipyrrolidin-1-ylbutan-2-yl)piperidine.
| Compound Name | 1-(1-piperidin-1-yl-3,4-dipyrrolidin-1-ylbutan-2-yl)piperidine |
|---|---|
| PubChem CID | 123853107 |
| Molecular Formula | C22H42N4 |
| Molecular Weight | 362.61 g/mol |
| Exact Mass | 362.34 |
| IUPAC Name | 1-(1-piperidin-1-yl-3,4-dipyrrolidin-1-ylbutan-2-yl)piperidine |
| SMILES | C1CCN(CC(C(CN2CCCC2)N2CCCC2)N2CCCCC2)CC1 |
| InChI | InChI=1S/C22H42N4/c1-3-11-23(12-4-1)19-21(25-15-5-2-6-16-25)22(26-17-9-10-18-26)20-24-13-7-8-14-24/h21-22H,1-20H2 |
| InChIKey | KGVGBDDSGRCFOD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.61 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |