C20H24NO7+ — CID 123853344
hydroxy-[[4-hydroxy-6-[2-[(4-methoxyphenyl)methyl]phenoxy]oxan-2-yl]methoxy]-oxoazanium (PubChem CID 123853344) has the molecular formula C20H24NO7+ and a molecular weight of 390.41 g/mol. Its IUPAC name is hydroxy-[[4-hydroxy-6-[2-[(4-methoxyphenyl)methyl]phenoxy]oxan-2-yl]methoxy]-oxoazanium.
| Compound Name | hydroxy-[[4-hydroxy-6-[2-[(4-methoxyphenyl)methyl]phenoxy]oxan-2-yl]methoxy]-oxoazanium |
|---|---|
| PubChem CID | 123853344 |
| Molecular Formula | C20H24NO7+ |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | hydroxy-[[4-hydroxy-6-[2-[(4-methoxyphenyl)methyl]phenoxy]oxan-2-yl]methoxy]-oxoazanium |
| SMILES | COc1ccc(Cc2ccccc2OC2CC(O)CC(CO[N+](=O)O)O2)cc1 |
| InChI | InChI=1S/C20H24NO7/c1-25-17-8-6-14(7-9-17)10-15-4-2-3-5-19(15)28-20-12-16(22)11-18(27-20)13-26-21(23)24/h2-9,16,18,20,22H,10-13H2,1H3,(H,23,24)/q+1 |
| InChIKey | PEMCUULMKUANLU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|