methyl 2-(2,3-dicyanopropylideneamino)-5-fluorobenzoate

C13H10FN3O2 — CID 123853590

IUPACmethyl 2-(2,3-dicyanopropylideneamino)-5-fluorobenzoate
SMILESCOC(=O)c1cc(F)ccc1/N=C/C(C#N)CC#N
InChIInChI=1S/C13H10FN3O2/c1-19-13(18)11-6-10(14)2-3-12(11)17-8-9(7-16)4-5-15/h2-3,6,8-9H,4H2,1H3/b17-8+
InChIKeyFWFAATHXLFGPCL-CAOOACKPSA-N
MW259.24 g/mol
LogP2.37
Rot. Bonds4

About methyl 2-(2,3-dicyanopropylideneamino)-5-fluorobenzoate

methyl 2-(2,3-dicyanopropylideneamino)-5-fluorobenzoate (PubChem CID 123853590) has the molecular formula C13H10FN3O2 and a molecular weight of 259.24 g/mol. Its IUPAC name is methyl 2-(2,3-dicyanopropylideneamino)-5-fluorobenzoate.

Molecular Properties

Compound Namemethyl 2-(2,3-dicyanopropylideneamino)-5-fluorobenzoate
PubChem CID123853590
Molecular FormulaC13H10FN3O2
Molecular Weight259.24 g/mol
Exact Mass259.08
IUPAC Namemethyl 2-(2,3-dicyanopropylideneamino)-5-fluorobenzoate
SMILESCOC(=O)c1cc(F)ccc1/N=C/C(C#N)CC#N
InChIInChI=1S/C13H10FN3O2/c1-19-13(18)11-6-10(14)2-3-12(11)17-8-9(7-16)4-5-15/h2-3,6,8-9H,4H2,1H3/b17-8+
InChIKeyFWFAATHXLFGPCL-CAOOACKPSA-N
XLogP2.37
TPSA86.24 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.24
LogP ≤ 52.37
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze methyl 2-(2,3-dicyanopropylideneamino)-5-fluorobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2,3-dicyanopropylideneamino)-5-fluorobenzoate?
The IUPAC name of methyl 2-(2,3-dicyanopropylideneamino)-5-fluorobenzoate (CID 123853590) is methyl 2-(2,3-dicyanopropylideneamino)-5-fluorobenzoate.
What is the SMILES notation for methyl 2-(2,3-dicyanopropylideneamino)-5-fluorobenzoate?
The canonical SMILES for methyl 2-(2,3-dicyanopropylideneamino)-5-fluorobenzoate is COC(=O)c1cc(F)ccc1/N=C/C(C#N)CC#N.
What is the InChIKey of methyl 2-(2,3-dicyanopropylideneamino)-5-fluorobenzoate?
The InChIKey is FWFAATHXLFGPCL-CAOOACKPSA-N. The full InChI is InChI=1S/C13H10FN3O2/c1-19-13(18)11-6-10(14)2-3-12(11)17-8-9(7-16)4-5-15/h2-3,6,8-9H,4H2,1H3/b17-8+.
What are the key properties of methyl 2-(2,3-dicyanopropylideneamino)-5-fluorobenzoate?
methyl 2-(2,3-dicyanopropylideneamino)-5-fluorobenzoate has a molecular weight of 259.24 g/mol, XLogP of 2.37, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,3-dicyanopropylideneamino)-5-fluorobenzoate is sourced from PubChem (CID 123853590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).