C17H29N3O — CID 123853677
4-[2-[4-(3-methylbuta-1,3-dienyl)cyclohepta-3,5-dien-1-yl]hydrazinyl]butoxymethanamine (PubChem CID 123853677) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is 4-[2-[4-(3-methylbuta-1,3-dienyl)cyclohepta-3,5-dien-1-yl]hydrazinyl]butoxymethanamine.
| Compound Name | 4-[2-[4-(3-methylbuta-1,3-dienyl)cyclohepta-3,5-dien-1-yl]hydrazinyl]butoxymethanamine |
|---|---|
| PubChem CID | 123853677 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | 4-[2-[4-(3-methylbuta-1,3-dienyl)cyclohepta-3,5-dien-1-yl]hydrazinyl]butoxymethanamine |
| SMILES | C=C(C)C=CC1=CCC(NNCCCCOCN)CC=C1 |
| InChI | InChI=1S/C17H29N3O/c1-15(2)8-9-16-6-5-7-17(11-10-16)20-19-12-3-4-13-21-14-18/h5-6,8-10,17,19-20H,1,3-4,7,11-14,18H2,2H3 |
| InChIKey | WRCQPQNPRUCHIR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|