C24H27F3N2O2S — CID 123853981
2-(2,6-diethyl-4-methylphenyl)-5-[2-[6-(trifluoromethyl)pyridazin-3-yl]sulfanylethyl]cyclohexane-1,3-dione (PubChem CID 123853981) has the molecular formula C24H27F3N2O2S and a molecular weight of 464.55 g/mol. Its IUPAC name is 2-(2,6-diethyl-4-methylphenyl)-5-[2-[6-(trifluoromethyl)pyridazin-3-yl]sulfanylethyl]cyclohexane-1,3-dione.
| Compound Name | 2-(2,6-diethyl-4-methylphenyl)-5-[2-[6-(trifluoromethyl)pyridazin-3-yl]sulfanylethyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 123853981 |
| Molecular Formula | C24H27F3N2O2S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 2-(2,6-diethyl-4-methylphenyl)-5-[2-[6-(trifluoromethyl)pyridazin-3-yl]sulfanylethyl]cyclohexane-1,3-dione |
| SMILES | CCc1cc(C)cc(CC)c1C1C(=O)CC(CCSc2ccc(C(F)(F)F)nn2)CC1=O |
| InChI | InChI=1S/C24H27F3N2O2S/c1-4-16-10-14(3)11-17(5-2)22(16)23-18(30)12-15(13-19(23)31)8-9-32-21-7-6-20(28-29-21)24(25,26)27/h6-7,10-11,15,23H,4-5,8-9,12-13H2,1-3H3 |
| InChIKey | OOSZSGVFDDBBTE-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|