C25H29ClF3N3O4 — CID 123854385
5-[2-[2-[5-chloro-2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]-1-(3-hydroxypropyl)indole-7-carboxamide (PubChem CID 123854385) has the molecular formula C25H29ClF3N3O4 and a molecular weight of 527.97 g/mol. Its IUPAC name is 5-[2-[2-[5-chloro-2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]-1-(3-hydroxypropyl)indole-7-carboxamide.
| Compound Name | 5-[2-[2-[5-chloro-2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]-1-(3-hydroxypropyl)indole-7-carboxamide |
|---|---|
| PubChem CID | 123854385 |
| Molecular Formula | C25H29ClF3N3O4 |
| Molecular Weight | 527.97 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | 5-[2-[2-[5-chloro-2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]-1-(3-hydroxypropyl)indole-7-carboxamide |
| SMILES | CC(Cc1cc(C(N)=O)c2c(ccn2CCCO)c1)NCCOc1cc(Cl)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C25H29ClF3N3O4/c1-16(31-6-10-35-22-14-19(26)3-4-21(22)36-15-25(27,28)29)11-17-12-18-5-8-32(7-2-9-33)23(18)20(13-17)24(30)34/h3-5,8,12-14,16,31,33H,2,6-7,9-11,15H2,1H3,(H2,30,34) |
| InChIKey | HWLHWHNTJPQILF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.97 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|