C28H41BN4O5 — CID 123854605
3-[4-[4-[3-[[3-(aminomethyl)-1-hydroxy-3H-2,1-benzoxaborol-7-yl]oxy]propyl]piperazin-1-yl]phenyl]-5-ethyl-1,3-oxazolidin-2-one;ethane (PubChem CID 123854605) has the molecular formula C28H41BN4O5 and a molecular weight of 524.47 g/mol. Its IUPAC name is 3-[4-[4-[3-[[3-(aminomethyl)-1-hydroxy-3H-2,1-benzoxaborol-7-yl]oxy]propyl]piperazin-1-yl]phenyl]-5-ethyl-1,3-oxazolidin-2-one;ethane.
| Compound Name | 3-[4-[4-[3-[[3-(aminomethyl)-1-hydroxy-3H-2,1-benzoxaborol-7-yl]oxy]propyl]piperazin-1-yl]phenyl]-5-ethyl-1,3-oxazolidin-2-one;ethane |
|---|---|
| PubChem CID | 123854605 |
| Molecular Formula | C28H41BN4O5 |
| Molecular Weight | 524.47 g/mol |
| Exact Mass | 524.32 |
| IUPAC Name | 3-[4-[4-[3-[[3-(aminomethyl)-1-hydroxy-3H-2,1-benzoxaborol-7-yl]oxy]propyl]piperazin-1-yl]phenyl]-5-ethyl-1,3-oxazolidin-2-one;ethane |
| SMILES | CC.CCC1CN(c2ccc(N3CCN(CCCOc4cccc5c4B(O)OC5CN)CC3)cc2)C(=O)O1 |
| InChI | InChI=1S/C26H35BN4O5.C2H6/c1-2-21-18-31(26(32)35-21)20-9-7-19(8-10-20)30-14-12-29(13-15-30)11-4-16-34-23-6-3-5-22-24(17-28)36-27(33)25(22)23;1-2/h3,5-10,21,24,33H,2,4,11-18,28H2,1H3;1-2H3 |
| InChIKey | MWTLPUALUBMFPQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 100.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|