C28H33N3O4S — CID 123854729
tert-butyl 4-[5-(1-ethoxyethenyl)-4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylate (PubChem CID 123854729) has the molecular formula C28H33N3O4S and a molecular weight of 507.66 g/mol. Its IUPAC name is tert-butyl 4-[5-(1-ethoxyethenyl)-4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-(1-ethoxyethenyl)-4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 123854729 |
| Molecular Formula | C28H33N3O4S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | tert-butyl 4-[5-(1-ethoxyethenyl)-4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylate |
| SMILES | C=C(OCC)c1sc(N2CCN(C(=O)OC(C)(C)C)CC2)nc1-c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C28H33N3O4S/c1-6-33-20(2)25-24(21-12-14-23(15-13-21)34-22-10-8-7-9-11-22)29-26(36-25)30-16-18-31(19-17-30)27(32)35-28(3,4)5/h7-15H,2,6,16-19H2,1,3-5H3 |
| InChIKey | GXTRBZLTXVPWAV-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|